Nitrobenzoic acids and derivatives
Chemscene ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
eMolecules 773109-32-3 | 2-AMINO-3-CHLORO-5-NITROBENZOIC ACID | MFCD06208323 | 1g
WuXi ChemSupply | 2-AMINO-3-CHLORO-5-NITROBENZOIC ACID | 1g | 599170767 | LN03282369 | 95.000 | 773109-32-3 | MFCD06208323 | 216.580 | C7H5ClN2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 446-09-3 | 1-Bromo-4-fluoro-2-nitrobenzene | Combi-Blocks | MFCD00055530 | 219.997 | C6H3BrFNO2 | 98.000 | [O-][N+](=O)c1cc(F)ccc1Br | 5g | 117540004](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000492306.jpg-250.jpg)
eMolecules 446-09-3 | 1-Bromo-4-fluoro-2-nitrobenzene | Combi-Blocks | MFCD00055530 | 219.997 | C6H3BrFNO2 | 98.000 | [O-][N+](=O)c1cc(F)ccc1Br | 5g | 117540004
1-Bromo-4-fluoro-2-nitrobenzene | Combi-Blocks | 446-09-3 | MFCD00055530 | 219.997 | C6H3BrFNO2 | 98.000 | [O-][N+](=O)c1cc(F)ccc1Br | 5g | 117540004
![Sigma Aldrich Fine Chemicals Biosciences 6-Nitrobenzo[a]pyrene BCR(R), certified reference material | 63041-90-7 | MFCD00215956 | 10MG](https://assets.fishersci.com/TFS-Assets/CCG/product-images/501762332.PNG-250.jpg)
Sigma Aldrich Fine Chemicals Biosciences 6-Nitrobenzo[a]pyrene BCR(R), certified reference material | 63041-90-7 | MFCD00215956 | 10MG
6-Nitrobenzo[a]pyrene BCR(R), certified reference material | Mol Wt: 297.31 | 63041-90-7 | MFCD00215956 | 10MG
Medchemexpress LLC 2-hydroxy-3-nitrobenzaldehyde | 5274-70-4 | MFCD00041874 | 500mg
2-Hydroxy-3-nitrobenzaldehyde is a drug impurity
Medchemexpress LLC 3-nitrobenzoic acid | 121-92-6 | MFCD00007251 | 1000g
3-Nitrobenzoic acid (m-Carboxynitrobenzene m-Nitrobenzenecarboxylic acid m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols[1][2]